The disoium cottonseed wasted-oil monoethanolamine sulfosuccinate was synthesized from natural cottonseed wasted-oil. By orthogonal experiments

The optimized reaction conditions of amidation are reaction temperature 80℃

reaction time 3h

amount of catalyst 4.5%(based on the weight of reations) and n(RCOOCH3):n(H2NCH2CH2OH)=1:1.1. The surface properties were detected and the results showed that the monoethanolamine sulfosuccinate was a good surfactant which can produce ultra-low interfacial tension (10-3 mN/m order) and can be used for ejecting rock-oil.